1-(4-chlorophenyl)-2-methylpropan-2-yl alaninate h

CAS: 60719-83-7
Mol wt: 292.2
Smiles: ClC1=CC=C(CC(C)(C)OC(C(N)C)=O)C=C1.Cl
Packaging quantity Price Availabiliy Sub Total
250MG 1050
1G
5G
25G